Canonical_QSARr
stringlengths 1
314
| CATMoS_LD50_mgkg
float64 0.01
10k
| num_ghose_violations
float64 0
4
| num_lead_likeness_violations
float64 0
3
| num_lipinski_violations
float64 0
4
| molecular_mass
float64 12
2.29k
| num_carbon_atoms
float64 0
132
| num_oxygen_atoms
float64 0
46
| SMILES
stringlengths 1
314
| log10_LD50
float64 -2
4
| Name
stringlengths 3
196
⌀ |
---|---|---|---|---|---|---|---|---|---|---|
C1CCCCN1 | 289.5 | 1 | 2 | 0 | 85.15 | 5 | 0 | C1CCCCN1 | 2.461649 | Piperidine, hydrochloride (1:1) |
C1CCCCN1SC1NC2=CC=CC=C2N=1 | 853 | 4 | 2 | 0 | 233.34 | 12 | 0 | C1CCCCN1SC1NC2=CC=CC=C2N=1 | 2.930949 | Piperidine, 1-(1H-benzimidazol-2-ylthio)- |
C1CCCCN2N=NN=C21 | 140 | 2 | 2 | 0 | 138.174 | 6 | 0 | C1CCCCN2N=NN=C21 | 2.146128 | Pentylenetetrazol |
C1CCCN1 | 365 | 1 | 2 | 0 | 71.123 | 4 | 0 | C1CCCN1 | 2.562293 | Pyrrolidine |
C1CCCO1 | 1,650 | 1 | 2 | 0 | 72.107 | 4 | 1 | C1CCCO1 | 3.217484 | Tetrahydrofuran |
C1CCCS1 | 1,850 | 1 | 2 | 0 | 88.175 | 4 | 0 | C1CCCS1 | 3.267172 | Tetrahydrothiophene |
C1CCN2CCCCCC2=N1 | 448 | 3 | 2 | 0 | 152.241 | 9 | 0 | C1CCN2CCCCCC2=N1 | 2.651278 | Formic acid, compd. with 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine (1:1) |
C1CCN2CCCN=C2N1 | 550 | 3 | 2 | 0 | 139.202 | 7 | 0 | C1CCN2CCCN=C2N1 | 2.740363 | 1,3,4,6,7,8-Hexahydro-2H-pyrimido(1,2-a)pyrimidine |
C1CCNCCN1 | 2,830 | 0 | 2 | 0 | 100.165 | 5 | 0 | C1CCNCCN1 | 3.451786 | 1H-1,4-Diazepine, hexahydro- |
C1CCOC2CCCCCCCCCCC=21 | 2,751 | 4 | 1 | 0 | 222.372 | 15 | 1 | C1CCOC2CCCCCCCCCCC=21 | 3.439491 | 2H-Cyclododeca[b]pyran, 3,4,5,6,7,8,9,10,11,12,13,14-dodecahydro- |
C1CCOC=C1 | 4,600 | 1 | 2 | 0 | 84.118 | 5 | 1 | C1CCOC=C1 | 3.662758 | 3,4-Dihydro-2H-pyran |
C1CC[SiH2]1 | 1,539 | 1 | 2 | 0 | 72.183 | 3 | 0 | C1CC[SiH2]1 | 3.187239 | Silacyclobutane |
C1CN(CCN1)C(C1C=CC=CC=1)C1C=CC=CC=1 | 500 | 4 | 3 | 0 | 252.361 | 17 | 0 | C1CN(CCN1)C(C1C=CC=CC=1)C1C=CC=CC=1 | 2.69897 | Norcyclizine |
C1CN(CCN1)C1C=CC=CC=1 | 210 | 4 | 2 | 0 | 162.236 | 10 | 0 | C1CN(CCN1)C1C=CC=CC=1 | 2.322219 | Phenylpiperazine |
C1CN(CCO1)C(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1 | 146 | 4 | 2 | 0 | 329.443 | 23 | 1 | C1CN(CCO1)C(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1 | 2.164353 | Trifenmorph |
C1CN(CCO1)C1C=CC=CC=1 | 930 | 4 | 2 | 0 | 163.22 | 10 | 1 | C1CN(CCO1)C1C=CC=CC=1 | 2.968483 | Morpholine, 4-phenyl- |
C1CN(CCO1)C1CCCCC1 | 178 | 4 | 2 | 0 | 169.268 | 10 | 1 | C1CN(CCO1)C1CCCCC1 | 2.25042 | Morpholine, 4-cyclohexyl- |
C1CN(CCOC2=NNC3CCCCC=32)CCO1 | 1,600 | 4 | 3 | 0 | 251.33 | 13 | 2 | C1CN(CCOC2=NNC3CCCCC=32)CCO1 | 3.20412 | 1H-Indazole, 4,5,6,7-tetrahydro-3-(2-(4-morpholinyl)ethoxy)- |
C1CN1 | 10 | 0 | 2 | 0 | 43.069 | 2 | 0 | C1CN1 | 1 | Ethyleneimine |
C1CN1C1N=C(N=C(N=1)N1CC1)N1CC1 | 13 | 3 | 2 | 0 | 204.237 | 9 | 0 | C1CN1C1N=C(N=C(N=1)N1CC1)N1CC1 | 1.113943 | Triethylenemelamine |
C1CN2CCC1CC2 | 81.2 | 2 | 2 | 0 | 111.188 | 7 | 0 | C1CN2CCC1CC2 | 1.909556 | Quinuclidine |
C1CN2CCN1CC2 | 1,865 | 2 | 2 | 0 | 112.176 | 6 | 0 | C1CN2CCN1CC2 | 3.270679 | 1,4-Diazabicyclo[2.2.2]octane, diacetate |
C1CN=C(N1)C1C=CC=CC=1 | 314 | 3 | 2 | 0 | 146.193 | 9 | 0 | C1CN=C(N1)C1C=CC=CC=1 | 2.49693 | 1H-Imidazole, 4,5-dihydro-2-phenyl- |
C1CNCCN1 | 3,737.5 | 0 | 2 | 0 | 86.138 | 4 | 0 | C1CNCCN1 | 3.572581 | Piperazine hexahydrate |
C1CNCCNCCNCCN1 | 1,003 | 3 | 2 | 0 | 172.276 | 8 | 0 | C1CNCCNCCNCCN1 | 3.001301 | Cyclen tetrahydrochloride |
C1CO1 | 201 | 1 | 2 | 0 | 44.053 | 2 | 1 | C1CO1 | 2.303196 | Ethylene oxide |
C1COC(NC(C2CC2)C2CC2)=N1 | 295 | 4 | 2 | 0 | 180.251 | 10 | 1 | C1COC(NC(C2CC2)C2CC2)=N1 | 2.469822 | Rilmenidine |
C1COC2=CSC=C2O1 | 1,150 | 1 | 2 | 0 | 142.179 | 6 | 2 | C1COC2=CSC=C2O1 | 3.060698 | Thieno[3,4-b]-1,4-dioxin, 2,3-dihydro- |
C1COC2C=CC=CC=2OCCOCCOC2=CC=CC=C2OCCO1 | 2,600 | 4 | 2 | 0 | 360.406 | 20 | 6 | C1COC2C=CC=CC=2OCCOCCOC2=CC=CC=C2OCCO1 | 3.414973 | Dibenzo-18-crown-6 |
C1COC2CCCCC2OCCOCCOC2CCCCC2OCCO1 | 176 | 4 | 2 | 0 | 372.502 | 20 | 6 | C1COC2CCCCC2OCCOCCOC2CCCCC2OCCO1 | 2.245513 | Dibenzo[b,k][1,4,7,10,13,16]hexaoxacyclooctadecin, eicosahydro- |
C1COCCN1 | 2,280.666667 | 1 | 2 | 0 | 87.122 | 4 | 1 | C1COCCN1 | 3.358062 | Morpholine, acetate |
C1COCCN1CCOCCN1CCOCC1 | 2,528 | 4 | 2 | 0 | 244.335 | 12 | 3 | C1COCCN1CCOCCN1CCOCC1 | 3.402777 | 4,4'-(Oxydiethylene)bis(morpholine) |
C1COCCN1SC1=NC2C=CC=CC=2S1 | 8,970 | 4 | 3 | 0 | 252.364 | 11 | 1 | C1COCCN1SC1=NC2C=CC=CC=2S1 | 3.952792 | N-Oxydiethylenebenzothiazole-2-sulfenamide |
C1COCCN1SSN1CCOCC1 | 4,950 | 4 | 2 | 0 | 236.362 | 8 | 2 | C1COCCN1SSN1CCOCC1 | 3.694605 | 4,4'-Dithiodimorpholine |
C1COCCN1SSSSN1CCOCC1 | 4,800 | 4 | 3 | 0 | 300.496 | 8 | 2 | C1COCCN1SSSSN1CCOCC1 | 3.681241 | Morpholine, 4,4'-tetrathiobis- |
C1COCCNCCOCCOCCNCCO1 | 3,400 | 3 | 3 | 0 | 262.35 | 12 | 4 | C1COCCNCCOCCOCCNCCO1 | 3.531479 | Cryptand 2.2 |
C1COCCO1 | 4,675 | 1 | 2 | 0 | 88.106 | 4 | 2 | C1COCCO1 | 3.669782 | 1,4-Dioxane |
C1COCCOC2CCCCC2OCCOCCOCCOC2CCCCC2OCCO1 | 75 | 3 | 2 | 0 | 460.608 | 24 | 8 | C1COCCOC2CCCCC2OCCOCCOCCOC2CCCCC2OCCO1 | 1.875061 | null |
C1COCCOCCOCCO1 | 2,830 | 4 | 2 | 0 | 176.212 | 8 | 4 | C1COCCOCCOCCO1 | 3.451786 | 1,4,7,10-Tetraoxacyclododecane |
C1COCCOCCOCCOCCO1 | 1,410 | 4 | 2 | 0 | 220.265 | 10 | 5 | C1COCCOCCOCCOCCO1 | 3.149219 | 1,4,7,10,13-Pentaoxacyclopentadecane |
C1COCCOCCOCCOCCOCCO1 | 525 | 4 | 3 | 0 | 264.318 | 12 | 6 | C1COCCOCCOCCOCCOCCO1 | 2.720159 | 18-Crown-6? |
C1CO[Si]2(OCCN1CCO2)C1C=CC=CC=1 | 1.48 | 4 | 3 | 0 | 251.358 | 12 | 3 | C1CO[Si]2(OCCN1CCO2)C1C=CC=CC=1 | 0.170262 | Phenylsilatrane |
C1CS1 | 178 | 1 | 2 | 0 | 60.121 | 2 | 0 | C1CS1 | 2.25042 | Ethylene sulfide |
C1CSC(NC2=CC=CC3=CC=CC=C32)=N1 | 50 | 4 | 2 | 0 | 228.32 | 13 | 0 | C1CSC(NC2=CC=CC3=CC=CC=C32)=N1 | 1.69897 | 2-Thiazoline, 2-(1-naphthylamino)- |
C1CSCCO1 | 2,830 | 1 | 2 | 0 | 104.174 | 4 | 1 | C1CSCCO1 | 3.451786 | 1,4-Oxathiane |
C1CSCCS1 | 2,768 | 1 | 2 | 0 | 120.242 | 4 | 0 | C1CSCCS1 | 3.442166 | 1,4-Dithiane |
C1C[N+]2=CC=CC=C2C2C=CC=C[N+]=21 | 225.5 | 4 | 2 | 0 | 184.242 | 12 | 0 | C1C[N+]2=CC=CC=C2C2C=CC=C[N+]=21 | 2.353147 | Diquat |
C1C[N+]2C=CC=CC=2C2C=CC=C[N+]=21 | 205 | 4 | 2 | 0 | 184.242 | 12 | 0 | C1C[N+]2C=CC=CC=2C2C=CC=C[N+]=21 | 2.311754 | Diquat dibromide monohydrate |
C1N2CN3CN1CN(C2)C3 | 10,001 | 1 | 2 | 0 | 140.19 | 6 | 0 | C1N2CN3CN1CN(C2)C3 | 4.000043 | Hexamethylene tetramine hydrochloride |
C1NC=CN=1 | 965 | 1 | 2 | 0 | 68.079 | 3 | 0 | C1NC=CN=1 | 2.984527 | Imidazole |
C1NCCC2C=CC=CC=21 | 300 | 3 | 2 | 0 | 133.194 | 9 | 0 | C1NCCC2C=CC=CC=21 | 2.477121 | 1,2,3,4-Tetrahydroisoquinoline |
C1NNCN2CNNCN21 | 397 | 1 | 2 | 0 | 144.182 | 4 | 0 | C1NNCN2CNNCN21 | 2.598791 | Tetraformaltrisazine |
C1OC(OCC21COC(OC2)C1CC=CCC1)C1CC=CCC1 | 7,500 | 4 | 3 | 0 | 320.429 | 19 | 4 | C1OC(OCC21COC(OC2)C1CC=CCC1)C1CC=CCC1 | 3.875061 | 3,9-Dicyclohex-3-enyl-2,4,8,10-tetraoxaspiro[5.5]undecane |
C1OC1C1C=CC2OC=2C=1 | 2,830 | 1 | 2 | 0 | 134.134 | 8 | 2 | C1OC1C1C=CC2OC=2C=1 | 3.451786 | null |
C1OC1C1C=CC=CC=1 | 3,806 | 1 | 2 | 0 | 120.151 | 8 | 1 | C1OC1C1C=CC=CC=1 | 3.580469 | Styrene oxide |
C1OC1C1CO1 | 78 | 1 | 2 | 0 | 86.09 | 4 | 2 | C1OC1C1CO1 | 1.892095 | 2,2'-Bioxirane |
C1OC2=CC=CC=C2O1 | 580 | 1 | 2 | 0 | 122.123 | 7 | 2 | C1OC2=CC=CC=C2O1 | 2.763428 | 1,3-Benzodioxolane |
C1OC2C=CC(CCC(CCC3=CC4OCOC=4C=C3)N3CCCC3)=CC=2O1 | 565 | 4 | 1 | 0 | 381.472 | 23 | 4 | C1OC2C=CC(CCC(CCC3=CC4OCOC=4C=C3)N3CCCC3)=CC=2O1 | 2.752048 | Pyrrolidine, 1-(3-(1,3-benzodioxol-5-yl)-1-(2-(1,3-benzodioxol-5-yl)ethyl)propyl)-, 2-hydroxy-1,2,3-propanetricarboxylate (salt) |
C1OCCCCO1 | 4,523 | 1 | 2 | 0 | 102.133 | 5 | 2 | C1OCCCCO1 | 3.655427 | 1,3-Dioxepane |
C1OCCO1 | 4,163 | 1 | 2 | 0 | 74.079 | 3 | 2 | C1OCCO1 | 3.619406 | 1,3-Dioxolane |
C1OCOCO1 | 8,500 | 1 | 2 | 0 | 90.078 | 3 | 3 | C1OCOCO1 | 3.929419 | 1,3,5-Trioxane |
C=C(C1C=CC=CC=1)C1C=CC=CC=1 | 2,751 | 4 | 1 | 0 | 180.25 | 14 | 0 | C=C(C1C=CC=CC=1)C1C=CC=CC=1 | 3.439491 | Benzene, 1,1'-ethenylidenebis- |
C=C(CC(=O)C1C=CC(=CC=1)C1=CC=CC=C1Cl)C(O)=O | 2,400 | 4 | 2 | 0 | 300.741 | 17 | 3 | C=C(CC(=O)C1C=CC(=CC=1)C1=CC=CC=C1Cl)C(O)=O | 3.380211 | Itanoxone |
C=C(CC(O)=O)C(O)=O | 2,969 | 1 | 2 | 0 | 130.099 | 5 | 4 | C=C(CC(O)=O)C(O)=O | 3.47261 | Butanedioic acid, methylene-, disodium salt |
C=C(CCl)CCl | 150 | 1 | 2 | 0 | 124.998 | 4 | 0 | C=C(CCl)CCl | 2.176091 | 3-Chloro-2-chloromethyl-1-propene |
C=C(Cl)C#N | 25 | 1 | 2 | 0 | 87.509 | 3 | 0 | C=C(Cl)C#N | 1.39794 | 2-Chloroacrylonitrile |
C=C(Cl)C(=C)Cl | 161 | 1 | 2 | 0 | 122.982 | 4 | 0 | C=C(Cl)C(=C)Cl | 2.206826 | 2,3-Dichloro-1,3-butadiene |
C=C(Cl)C(Cl)=C(Cl)Cl | 421 | 2 | 1 | 0 | 191.872 | 4 | 0 | C=C(Cl)C(Cl)=C(Cl)Cl | 2.624282 | 1,3-Butadiene, 1,1,2,3-tetrachloro- |
C=C(Cl)C(Cl)CCl | 341 | 1 | 2 | 0 | 159.443 | 4 | 0 | C=C(Cl)C(Cl)CCl | 2.532754 | 2,3,4-Trichloro-1-butene |
C=C(Cl)C1C=CC(=CC=1)[N+]([O-])=O | 710 | 3 | 2 | 0 | 183.594 | 8 | 2 | C=C(Cl)C1C=CC(=CC=1)[N+]([O-])=O | 2.851258 | Styrene, alpha-chloro-p-nitro- |
C=C(Cl)CCl | 320 | 1 | 2 | 0 | 110.971 | 3 | 0 | C=C(Cl)CCl | 2.50515 | 2,3-Dichloro-1-propene |
C=C(Cl)CN=C=S | 40 | 1 | 2 | 0 | 133.603 | 4 | 0 | C=C(Cl)CN=C=S | 1.60206 | Isothiocyanic acid, 2-chloroallyl ester |
C=C(Cl)Cl | 1,250 | 1 | 2 | 0 | 96.944 | 2 | 0 | C=C(Cl)Cl | 3.09691 | 1,1-Dichloroethylene |
C=C(F)CO | 130 | 1 | 2 | 0 | 76.07 | 3 | 1 | C=C(F)CO | 2.113943 | 2-Fluoro-2-propen-1-ol |
C=C1CC1CC(N)C(O)=O | 98 | 2 | 2 | 0 | 141.17 | 7 | 2 | C=C1CC1CC(N)C(O)=O | 1.991226 | Hypoglycine A |
C=CBr | 500 | 1 | 2 | 0 | 106.95 | 2 | 0 | C=CBr | 2.69897 | Vinyl bromide |
C=CC#N | 90 | 1 | 2 | 0 | 53.064 | 3 | 0 | C=CC#N | 1.954243 | Acrylonitrile |
C=CC(=C)Cl | 353 | 1 | 2 | 0 | 88.537 | 4 | 0 | C=CC(=C)Cl | 2.547775 | Chloroprene |
C=CC(=O)N1CN(CN(C1)C(=O)C=C)C(=O)C=C | 350 | 4 | 2 | 0 | 249.27 | 12 | 3 | C=CC(=O)N1CN(CN(C1)C(=O)C=C)C(=O)C=C | 2.544068 | Hexahydro-1,3,5-tris(1-oxoallyl)-1,3,5-triazine |
C=CC(=O)NC1C=CC(O)=CC=1 | 930 | 4 | 2 | 0 | 163.176 | 9 | 2 | C=CC(=O)NC1C=CC(O)=CC=1 | 2.968483 | Acrylanilide, 4'-hydroxy- |
C=CC(=O)NCNC(=O)C=C | 390 | 2 | 2 | 0 | 154.169 | 7 | 2 | C=CC(=O)NCNC(=O)C=C | 2.591065 | N,N'-Methylenebisacrylamide |
C=CC(=O)NCO | 391 | 0 | 2 | 0 | 101.105 | 4 | 2 | C=CC(=O)NCO | 2.592177 | N-Methylolacrylamide |
C=CC(=O)OC1=C(Br)C=C(Cl)C2C=CC=NC=21 | 10,000 | 4 | 2 | 0 | 312.55 | 12 | 2 | C=CC(=O)OC1=C(Br)C=C(Cl)C2C=CC=NC=21 | 4 | Halacrinate |
C=CC(=O)OCC(CO)(COC(=O)C=C)COC(=O)C=C | 1,830 | 4 | 2 | 0 | 298.291 | 14 | 7 | C=CC(=O)OCC(CO)(COC(=O)C=C)COC(=O)C=C | 3.262451 | Pentaerythritol triacrylate |
C=CC(=O)OCC(O)COC1C=CC=CC=1 | 3,500 | 4 | 2 | 0 | 222.24 | 12 | 4 | C=CC(=O)OCC(O)COC1C=CC=CC=1 | 3.544068 | 2-Hydroxy-3-phenoxypropyl prop-2-enoate |
C=CC(=O)OCC1C(Br)=C(Br)C(Br)=C(Br)C=1Br | 7,500 | 2 | 1 | 2 | 556.668 | 10 | 2 | C=CC(=O)OCC1C(Br)=C(Br)C(Br)=C(Br)C=1Br | 3.875061 | (Pentabromophenyl)methyl acrylate |
C=CC(=O)OCC1C=CC=CC=1 | 3,500 | 4 | 2 | 0 | 162.188 | 10 | 2 | C=CC(=O)OCC1C=CC=CC=1 | 3.544068 | Benzyl acrylate |
C=CC(=O)OCC1CCCO1 | 928 | 3 | 2 | 0 | 156.181 | 8 | 3 | C=CC(=O)OCC1CCCO1 | 2.967548 | Tetrahydrofurfuryl acrylate |
C=CC(=O)OCC1CO1 | 180 | 1 | 2 | 0 | 128.127 | 6 | 3 | C=CC(=O)OCC1CO1 | 2.255273 | Glycidyl acrylate |
C=CC(=O)OCCC#N | 180 | 1 | 2 | 0 | 125.127 | 6 | 2 | C=CC(=O)OCCC#N | 2.255273 | 2-Cyanoethyl prop-2-enoate |
C=CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | 3,500 | 4 | 0 | 0 | 418.149 | 11 | 2 | C=CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | 3.544068 | 2-Propenoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl ester |
C=CC(=O)OCCCCCCOC(=O)C=C | 5,626 | 4 | 1 | 0 | 226.272 | 12 | 4 | C=CC(=O)OCCCCCCOC(=O)C=C | 3.7502 | 1,6-Hexanediol diacrylate |
C=CC(=O)OCCCCO | 851 | 2 | 2 | 0 | 144.17 | 7 | 3 | C=CC(=O)OCCCCO | 2.92993 | 4-Hydroxybutyl prop-2-enoate |
C=CC(=O)OCCCCOC(=O)C=C | 1,265 | 4 | 2 | 0 | 198.218 | 10 | 4 | C=CC(=O)OCCCCOC(=O)C=C | 3.102091 | 1,4-Butanediol diacrylate |
C=CC(=O)OCCCCOC(=O)OC1C=CC(=CC=1)C(=O)C1C=CC=CC=1 | 3,600 | 4 | 0 | 0 | 368.385 | 21 | 6 | C=CC(=O)OCCCCOC(=O)OC1C=CC(=CC=1)C(=O)C1C=CC=CC=1 | 3.556303 | 2-Propenoic acid, 4-[[(4-benzoylphenoxy)carbonyl]oxy]butyl ester |
C=CC(=O)OCCCS(O)(=O)=O | 6,250 | 4 | 2 | 0 | 194.208 | 6 | 5 | C=CC(=O)OCCCS(O)(=O)=O | 3.79588 | 2-Propenoic acid, 3-sulfopropyl ester, sodium salt |
C=CC(=O)OCCCl | 180 | 1 | 2 | 0 | 134.562 | 5 | 2 | C=CC(=O)OCCCl | 2.255273 | 2-Chloroethyl acrylate |
C=CC(=O)OCCO | 805 | 1 | 2 | 0 | 116.116 | 5 | 3 | C=CC(=O)OCCO | 2.905796 | 2-Hydroxyethyl acrylate |
C=CC(=O)OCCOC(=O)C1=CC=C(C=C1C(O)=O)C(O)=O | 3,190 | 4 | 3 | 0 | 308.242 | 14 | 8 | C=CC(=O)OCCOC(=O)C1=CC=C(C=C1C(O)=O)C(O)=O | 3.503791 | 1,2,4-Benzenetricarboxylic acid, 1-[2-[(1-oxo-2-propen-1-yl)oxy]ethyl] ester |
C=CC(=O)OCCOC(=O)C=C | 300 | 4 | 2 | 0 | 170.164 | 8 | 4 | C=CC(=O)OCCOC(=O)C=C | 2.477121 | Ethylene acrylate |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.