Dataset Viewer
Auto-converted to Parquet
instruction
stringlengths
52
2.16k
output
stringlengths
1
833
input
stringclasses
1 value
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and tangier disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts aging, diabetic heart disease, and non-alcoholic fatty liver disease.
CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCC(C)C
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a apoptosis and a cholesterol translocation that impacts diabetic heart disease, barth syndrome, and aging. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts tangier disease and non-alcoholic fatty liver disease.
CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC
Generate a molecule that fulfills the requirement: The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts diabetic heart disease, tangier disease, and barth syndrome. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging and non-alcoholic fatty liver disease.
CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCC(C)C
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a plasma kallikrein inhibitor.
CC(CNC(=O)c1cn(Cc2ccc(Cn3ccccc3=O)cc2)nc1N)Oc1cccc(Cl)c1
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing mitochondrial structure that impacts aging, diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome.
CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a energy storage, nutrient, membrane stabilizer that impacts cardiovascular disease, metabolic syndrome, and pancreatitis. The molecule is a member of the thyroxine treatment class and affects both atherosclerosis and cancer. The molecule is a fat storage, a energy source, and a inflammatory, and it impacts obesity.
CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC(C)C
Conceptualize a molecule that meets the specified attribute(s): It belongs to the tgr5 agonist class of molecules.
N#Cc1ccc(CCNC(=O)C2CCN2c2cc(N3CCC(CCCC(=O)NC(CCCN=C(N)N)C(=O)O)CC3)nc(C(F)(F)F)n2)cc1
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a nutrient and thyroxine treatment, and it impacts cardiovascular disease. The molecule is a fat storage that impacts atherosclerosis, pancreatitis, and metabolic syndrome.
CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC(=O)CCCCCCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCCCCC
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome and aging. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease.
CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC
Could you please return a molecule that adheres to this description? The molecule is a pain treatment that impacts inflammatory disease treatment.
Cc1c(Cl)cccc1-n1ccn2c(SCC(=O)c3ccccc3C(F)(F)F)nnc2c1=O
Build a molecule that meets the requirement: The molecule is a energy storage, inflammatory, membrane stabilizer that impacts cancer, atherosclerosis, and obesity. The molecule is a fat storage and a energy source, belonging to the thyroxine treatment class of molecules. The molecule is a nutrient that impacts pancreatitis, cardiovascular disease, and metabolic syndrome.
CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C
Generate a molecule based on this description: The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts barth syndrome and tangier disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts diabetic heart disease, aging, and non-alcoholic fatty liver disease.
CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC
Could you please return a molecule that adheres to this description? The molecule is a energy storage, energy source, membrane stabilizer, nutrient that impacts cancer and obesity. The molecule is a inflammatory that impacts both cardiovascular disease and pancreatitis. The molecule is a fat storage that impacts metabolic syndrome, atherosclerosis, and thyroxine treatment.
CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCC(C)C
I need a molecule that meets the following conditions: The molecule is a liquid crystal display and belongs to the liquid crystal class of molecules. Please represent the molecule in SMILES.
CC1CCC(C(C)C)C(Oc2ccc(CC(=O)O)cc2)C1
Come up with a molecule based on the description: The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts tangier disease, diabetic heart disease, and aging. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts non-alcoholic fatty liver disease and barth syndrome.
CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC
Come up with a molecule based on the description: The molecule is a 11βhsd1 inhibitor that impacts diabetes treatment.
CC(C)n1c(-c2ccc3c(c2)CNC3=O)nnc1C(C)(C)Oc1c(F)cc(Cl)cc1F
Conceptualize a molecule that meets the specified attribute(s): The molecule is a energy source, stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation. The molecule is a emulsifier, energy storage, nutritional supplement that impacts diabetic heart disease and tangier disease. The molecule is a membrane stabilizer and a food additive, impacting both barth syndrome and non-alcoholic fatty liver disease. The molecule is a surfactant, a apoptosis, and a proton trap for oxidative phosphorylation, it impacts aging and is smooth.
CCCCCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC
Suppose there is a molecule that meets the following description: The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis that impacts tangier disease and aging. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease. Please write the SMILES representation of it.
CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC
The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts aging, diabetic heart disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts tangier disease and non-alcoholic fatty liver disease. Use the above information to create a molecule.
CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C
Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient.
COc1cc(CC(O)COC2OC(CO)C(O)C(O)C2O)cc(O)c1OC
Generate a molecule that fulfills the requirement: The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts diabetic heart disease, aging, and barth syndrome. The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and tangier disease.
CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCC(C)C
Come up with a molecule based on the description: The molecule is a anti bacterial.
CC(C)(C)OC(=O)NC12CCC(CCN3C(=O)COc4ccc(Br)cc43)(CC1)OC2
I need a molecule that meets the following conditions: The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts aging, tangier disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts diabetic heart disease and non-alcoholic fatty liver disease. Please represent the molecule in SMILES.
CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC
Generate a molecule based on this description: The molecule is a surfactant, emulsifier, energy source, nutritional supplement. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, food additive that impacts tangier disease and barth syndrome. The molecule is a apoptosis and a stabilizing mitochondrial structure, it impacts aging, and is smooth. The molecule is a cholesterol translocation, energy storage, membrane stabilizer that impacts non-alcoholic fatty liver disease and diabetic heart disease.
CCC(C)CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C
The molecule is a protein kinase inhibitor and pdk1 inhibitor, and it impacts cancer treatment. Use the above information to create a molecule.
Cc1[nH]c(C=C2C(=O)Nc3cc(C=CCNc4ncccc4C(=O)NCc4ccc(F)c(F)c4)ccc32)c(C)c1C(=O)O
I need a molecule that meets the following conditions: When heated to decomposition it emits acrid smoke and irritating fumes. The molecule has both a Bitter and unpleasant taste and a Pleasant odor. Please represent the molecule in SMILES.
COc1ccc(C(C)=O)cc1
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a nutrient that impacts parkinson's disease, alzheimer's disease, non-alcoholic fatty liver disease, and diabetes mellitus type 2.
CCCc1oc(CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CCC=CCC=CCCCC(C)O)c(C)c1C
Can you create a molecule that matches the given characteristics? The molecule is a anti viral member of the anti viral compound class.
O=C(NC1CCCC(Nc2nc(-c3[nH]nc4ncc(Cl)cc34)ncc2F)C1)N1CCCC1CO
Generate a molecule based on this description: The molecule is a kinase inhibitor.
CC(C)Cc1ncc(-c2cc(-c3ccccc3CNC(=O)OC(C)(C)C)nc(NCCN(C)C)n2)s1
Generate a molecule based on this description: The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation that impacts diabetic heart disease and tangier disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, barth syndrome, and aging.
CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a surfactant, energy storage, energy source, emulsifier, membrane stabilizer, nutrient.
CSC=CC(=O)OC1CC(C)C2(C)CC(=C(C)C)C(=O)CC2C1
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a orexin receptor antagonist.
Cc1nc2sccn2c1C(=O)NCC1CCCCN1C(=O)c1nc(C2CC2)sc1-c1cccc(C(F)(F)F)c1
Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient.
CC1(C)CCC2(C(=O)OC3OCC(O)C(OC4OC(CO)C(O)C(O)C4O)C3O)CCC3(C)C(=CCC4C5(C)CCC(OC6OC(CO)C(O)C(O)C6O)C(C)(COC6OC(CO)C(O)C(O)C6O)C5CCC43C)C2C1
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a energy storage, nutrient, emulsifier, surfactant, energy source, membrane stabilizer.
CC=C(C)C(=O)OC1CC(C)(C)CC2C3=CCC4C5(C)CCC(OC6OC(C(=O)O)C(O)C(OC7OCC(O)C(O)C7OC7OC(CO)C(O)C(O)C7O)C6OC6OC(CO)C(O)C(O)C6O)C(C)(CO)C5CCC4(C)C3(C)CC(O)C12CO
Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a apoptosis and a cholesterol translocation that impacts diabetic heart disease, aging, and barth syndrome.
CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC
Generate a molecule that fulfills the requirement: The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts aging and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts diabetic heart disease, tangier disease, and barth syndrome.
CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC
Suppose there is a molecule that meets the following description: The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts tangier disease, aging, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts diabetic heart disease and barth syndrome. Please write the SMILES representation of it.
CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C
Come up with a molecule based on the description: The molecule is a proton trap for oxidative phosphorylation, a membrane stabilizer, and a surfactant, and it impacts non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a apoptosis, which impacts both diabetic heart disease and barth syndrome, and is characterized as smooth. The molecule is a food additive, a energy storage, and a emulsifier, and it impacts tangier disease. The molecule is a energy source, nutritional supplement, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts aging.
CC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C
Suppose there is a molecule that meets the following description: The molecule is a apoptosis and a cholesterol translocation that impacts barth syndrome, diabetic heart disease, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and tangier disease. Please write the SMILES representation of it.
CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C
Conceptualize a molecule that meets the specified attribute(s): It belongs to the diabetes treatment class of molecules.
O=P(O)(O)CN(c1ccc2c(ccn2-c2ccc(N3CCCNCC3)nn2)c1)S(=O)(=O)C1C=C(Cl)C=C(Cl)C1
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a flavoring agent, savory, meaty, and sulfur.
COc1cc(C(=O)CO)cc(OC)c1O
I need a molecule that meets the following conditions: The molecule is a faah inhibitor. Please represent the molecule in SMILES.
CC1(C)COCN1C(=O)n1nnc2ncccc21
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts barth syndrome, tangier disease, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts diabetic heart disease and aging.
CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC
I need a molecule that meets the following conditions: The molecule is a nutrient that impacts both pancreatitis and atherosclerosis. The molecule is a fat storage that impacts cardiovascular disease, thyroxine treatment, and metabolic syndrome. Please represent the molecule in SMILES.
CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC
Build a molecule that meets the requirement: The molecule is anti cancer.
CC(C)=CCCC(C)=CCn1cc(CN2CCCC2)c2cc(F)ccc21
Could you please return a molecule that adheres to this description? The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts barth syndrome and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts tangier disease, non-alcoholic fatty liver disease, and aging.
CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC
Generate a molecule that fulfills the requirement: The molecule is cancer treatment.
CC(=CC=CN)Cc1ccccn1
Can you create a molecule that matches the given characteristics? The molecule is both a hcv inhibitor and a anti viral.
COc1ccc2c(c1)c(C#N)c(-c1ccc(NS(=O)(=O)C3CC3)cc1)n2C1CCC1
Conceptualize a molecule that meets the specified attribute(s): Hazardous decomposition products formed under fire conditions: carbon oxides, silicon oxides.
C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C
Give me a molecule that satisfies the conditions outlined in the description: The molecule is anti fungal and it impacts hypercholesterolemia treatment.
CC(C)(C)CN1C(=O)C(CCC#N)OC(c2ccccc2Cl)c2cc(Cl)ccc21
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome and tangier disease.
CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC
Build a molecule that meets the requirement: The molecule is a anti allergic and is anti allergic agent.
COc1c(OC(=O)c2ccccc2)c2cccc(OC(C)(C)C)c2oc1=O
Come up with a molecule based on the description: It impacts thyroxine treatment, metabolic syndrome, and pancreatitis. The molecule is a fat storage and a nutrient, impacting both cardiovascular disease and atherosclerosis.
CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCC=CCCCCCCCC
Suppose there is a molecule that meets the following description: The molecule is anti bacterial. Please write the SMILES representation of it.
CC(=O)Nc1ccc([N+](=O)[O-])c(-c2ccncc2)n1
The molecule is a apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and aging. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease. Use the above information to create a molecule.
CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C
It impacts atherosclerosis, metabolic syndrome, and pancreatitis. The molecule is a nutrient and a fat storage, it impacts cardiovascular disease, and is thyroxine treatment. Use the above information to create a molecule.
CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCC=CCCCCCCCC
Suppose there is a molecule that meets the following description: The molecule is a fat storage, energy source, and membrane stabilizer that has an effect on cancer and impacts both pancreatitis and atherosclerosis. The molecule is a inflammatory and energy storage, and it impacts cardiovascular disease. The molecule is a nutrient and belongs to the thyroxine treatment class of molecules, impacting both obesity and metabolic syndrome. Please write the SMILES representation of it.
CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C
Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts barth syndrome, tangier disease, and diabetic heart disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging and non-alcoholic fatty liver disease.
CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC
Generate a molecule that fulfills the requirement: The molecule is a nutrient that affects breast cancer by impacting cervical cancer, atherosclerosis, and ulcerative colitis.
CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCC(O)CC)COP(=O)([O-])OCC[N+](C)(C)C
Come up with a molecule based on the description: The molecule is a apoptosis and a membrane stabilizer, impacting both diabetic heart disease and tangier disease. The molecule is a emulsifier, a food additive, and a stabilizing mitochondrial structure, it impacts barth syndrome and is smooth. The molecule is a nutritional supplement, a cholesterol translocation, and a proton trap for oxidative phosphorylation, and it impacts non-alcoholic fatty liver disease. The molecule is a energy source, energy storage, stabilizing cytochrome oxidase, surfactant that impacts aging.
CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C
Conceptualize a molecule that meets the specified attribute(s): The molecule is a hmgcoa reductase inhibitor.
CC(C)Cc1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1CO
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a apoptosis that impacts aging, barth syndrome, and diabetic heart disease.
CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC
Give me a molecule that satisfies the conditions outlined in the description: The molecule is light-emitting.
Cc1ccccc1N(c1cccc(-c2cccc3c2oc2ccccc23)c1)c1ccc2ccc3c(N(c4cccc(-c5cccc6c5oc5ccccc56)c4)c4ccccc4C)ccc4ccc1c2c43
Could you please return a molecule that adheres to this description? It impacts diabetes mellitus type 1, cardiovascular disease, and diabetes mellitus type 2. The molecule is a nutrient that impacts insulin resistance, atherosclerosis, and pick's disease.
CCC=CCC=CCC(O)C=CC=CCC=CCCCC(=O)NC(COP(=O)([O-])OCC[N+](C)(C)C)C(O)CCCCCCCCCCCCCCC
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a phosphorescent emitter and is both phosphorescent and belongs to the electroluminescent and organic electroluminescent material classes of molecules.
O=P1(c2ccccc2)c2ccccc2-c2ccc3c4ccccc4n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2N1c1ccccc1
Build a molecule that meets the requirement: The molecule is thyroxine treatment and it impacts both atherosclerosis and metabolic syndrome. The molecule is a fat storage and a nutrient, impacting both cardiovascular disease and pancreatitis.
CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCCCCCC
Come up with a molecule based on the description: The molecule is anti oxidant.
C=C(C(=CC1C(O)=CC(O)=CC1C)CC1CC(O)C(O)C(O)C1O)c1ccc(O)c(O)c1
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a ccr2 antagonist.
Cc1c(Nc2ccc(Cl)c(Cl)c2)nc(C2CC2)nc1C(=O)N1CCC(NC2CCOCC2F)CC1
Generate a molecule based on this description: The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts aging and barth syndrome.
CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC
Can you create a molecule that matches the given characteristics? The molecule is a energy source that impacts inflammatory bowel disease, cardiovascular disease, and renal cell carcinoma. It impacts celiac disease, breast cancer, diabetes mellitus type 2, and heart failure.
CCCCCC=CCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C
Suppose there is a molecule that meets the following description: The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts barth syndrome, non-alcoholic fatty liver disease, and aging. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts diabetic heart disease and tangier disease. Please write the SMILES representation of it.
CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts barth syndrome, tangier disease, and aging.
CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts aging. The molecule is a stabilizing cytochrome oxidase that impacts tangier disease, diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome.
CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC
I need a molecule that meets the following conditions: The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts tangier disease. The molecule is a cholesterol translocation that impacts barth syndrome, diabetic heart disease, aging, and non-alcoholic fatty liver disease. Please represent the molecule in SMILES.
CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C
Generate a molecule that fulfills the requirement: The molecule is anti bacterial.
CCSc1c(C)[nH]c2c(Br)cc(F)c(F)c12
Can you create a molecule that matches the given characteristics? The molecule is a nutrient that affects breast cancer by impacting atherosclerosis, cervical cancer, and ulcerative colitis.
CCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a apoptosis and a cholesterol translocation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts tangier disease and barth syndrome.
CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCC
Can you create a molecule that matches the given characteristics? The molecule is a energy source, nutrient, energy storage, membrane stabilizer.
CCC(CCCC(=O)O)C(=O)O
The molecule is a member of the thyroxine treatment class and affects both metabolic syndrome and cardiovascular disease. The molecule is a fat storage and a nutrient, impacting both pancreatitis and atherosclerosis. Use the above information to create a molecule.
CCCCC=CCCCCCCCC(=O)OCC(COCCCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCCCCCCCC
Build a molecule that meets the requirement: The molecule is a thrombin inhibitor and belongs to the thrombosis treatment class of molecules.
COC(=O)Cc1cn(-c2cc(C)ccn2)cn1
Build a molecule that meets the requirement: The molecule is a apoptosis that impacts tangier disease, barth syndrome, non-alcoholic fatty liver disease, and aging. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease.
CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC
I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a anti viral.
CCC(C)(C)C1CC(F)(F)CC1C(N)=O
Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient.
CCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCC=CC=CC(=O)CCCCC
Give me a molecule that satisfies the conditions outlined in the description: It impacts cardiovascular disease, stomach cancer, parkinson's disease, and colorectal cancer. It has an effect on breast cancer, and impacts alzheimer's disease, diabetes mellitus, and seizure.
CCCCCCCCC=CCCCCCCCC(=O)OC1COC(=O)CCCC=CCC2C=CC(=O)C(C=CC(O)CCCCC)C(O)C(O)C(OP(=O)(O)OC1)C(O)C(O)C2O
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a anti viral.
COC(=O)CC1c2cccc(F)c2N=C(N2CCN(c3cccc(C)c3)CC2)N1c1cc(C(F)(F)F)ccc1SC
Based on the given information, generate a molecule that meets the desired specifications: The molecule is thyroxine treatment and it impacts both metabolic syndrome and pancreatitis. The molecule is a fat storage and a nutrient, impacting both cardiovascular disease and atherosclerosis.
CCCCCCCCC=CCCCCCCCCCC(=O)OCC(COCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC
Based on the given information, generate a molecule that meets the desired specifications: It has an effect on stomach cancer, and impacts seizure, parkinson's disease, and breast cancer. It has an effect on colorectal cancer, and impacts alzheimer's disease, diabetes mellitus, and cardiovascular disease.
CCCCCC=CCC=CCCCCCCCCCC(=O)OCC1COP(=O)(O)OC2C(O)C(O)C(O)C(CCCCCCC(=O)O1)C(=O)CC(O)C(C=CC(O)CCCCC)C(O)C2O
Give me a molecule that satisfies the conditions outlined in the description: The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts aging and tangier disease.
CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C
Build a molecule that meets the requirement: The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and diabetic heart disease. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts tangier disease, non-alcoholic fatty liver disease, and aging.
CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCC
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a energy source, inflammatory, energy storage, nutrient that belongs to the thyroxine treatment class of molecules and impacts atherosclerosis. The molecule is a membrane stabilizer that affects cancer by impacting pancreatitis. The molecule is a fat storage that impacts metabolic syndrome, cardiovascular disease, and obesity.
CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC
Suppose there is a molecule that meets the following description: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts barth syndrome, diabetic heart disease, and aging. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and tangier disease. Please write the SMILES representation of it.
CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC
I need a molecule that meets the following conditions: The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease and aging. Please represent the molecule in SMILES.
CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)C
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, tangier disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts non-alcoholic fatty liver disease and aging.
CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC
Generate a molecule based on this description: The molecule is a serotonin antagonist.
CCN1CCN(c2nc(-c3ccc(OCCO)cc3)cc3cc(F)ccc23)CC1.Cl.Cl
Can you create a molecule that matches the given characteristics? The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts aging, barth syndrome, and diabetic heart disease.
CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts diabetic heart disease, barth syndrome, and aging.
CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C
Come up with a molecule based on the description: The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts tangier disease and diabetic heart disease.
CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCC(C)CC
The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts diabetic heart disease and tangier disease. The molecule is a cholesterol translocation and a apoptosis that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. Use the above information to create a molecule.
CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C
Can you create a molecule that matches the given characteristics? The molecule is a anti bacterial.
Cc1ncc(SCC2=C(C(=O)O)N3C(=O)C(O)C3SC2)s1
Based on the given information, generate a molecule that meets the desired specifications: The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts tangier disease, aging, and barth syndrome. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts diabetic heart disease and non-alcoholic fatty liver disease.
CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC
End of preview. Expand in Data Studio
README.md exists but content is empty.
Downloads last month
7