Update app.py
Browse files
app.py
CHANGED
|
@@ -49,19 +49,23 @@ with col4:
|
|
| 49 |
option ="example"
|
| 50 |
molecule = 'O=C(C(C=C(F)C(F)=C1)=C1C/2=C(C#N)/C#N)C2=C/C3=C(CCCCCCCCCCC)C(S4)=C(S3)C5=C4C6=C(N5CC(CC)CCCC)C7=C(C(SC8=C9SC(/C=C%10C(C(C=C(F)C(F)=C%11)=C%11C\%10=C(C#N)C#N)=O)=C8CCCCCCCCCCC)=C9N7CC(CC)CCCC)C%12=NSN=C6%12'
|
| 51 |
do = 'CCCCC(CC)CC1=C(F)C=C(C2=C3C=C(C4=CC=C(C5=C6C(=O)C7=C(CC(CC)CCCC)SC(CC(CC)CCCC)=C7C(=O)C6=C(C6=CC=C(C)S6)S5)S4)SC3=C(C3=CC(F)=C(CC(CC)CCCC)S3)C3=C2SC(C)=C3)S1'
|
| 52 |
-
|
| 53 |
if option =="🎈Acceptor":
|
| 54 |
st.subheader("👨🔬**Input the SMILES of Acceptor Molecule**")
|
| 55 |
molecule = st.text_input("👨🔬**Input the SMILES of Acceptor Molecule**", label_visibility="hidden" )
|
| 56 |
acceptor= st_ketcher(molecule )
|
|
|
|
| 57 |
st.subheader(f"🏆**New SMILES of edited acceptor molecules**: {acceptor}")
|
|
|
|
| 58 |
st.subheader(":black[**🧡Input the SMILES of Donor Molecule**]")
|
| 59 |
donor= st.text_input(":black[**🧡Input the SMILES of Donor Molecule**]", label_visibility="hidden")
|
| 60 |
if option =="🎈Donor":
|
| 61 |
st.subheader("👨🔬**Input the SMILES of Donor Molecule**" )
|
| 62 |
do= st.text_input("👨🔬**Input the SMILES of Donor Molecule**" , label_visibility="hidden")
|
| 63 |
donor = st_ketcher(do)
|
|
|
|
| 64 |
st.subheader(f"🏆**New SMILES of edited donor molecules**: {donor}")
|
|
|
|
| 65 |
st.subheader(":black[**🧡Input the SMILES of Acceptor Molecule**]")
|
| 66 |
acceptor = st.text_input(":black[**🧡Input the SMILES of Acceptor Molecule**]", label_visibility="hidden")
|
| 67 |
if option =="example":
|
|
|
|
| 49 |
option ="example"
|
| 50 |
molecule = 'O=C(C(C=C(F)C(F)=C1)=C1C/2=C(C#N)/C#N)C2=C/C3=C(CCCCCCCCCCC)C(S4)=C(S3)C5=C4C6=C(N5CC(CC)CCCC)C7=C(C(SC8=C9SC(/C=C%10C(C(C=C(F)C(F)=C%11)=C%11C\%10=C(C#N)C#N)=O)=C8CCCCCCCCCCC)=C9N7CC(CC)CCCC)C%12=NSN=C6%12'
|
| 51 |
do = 'CCCCC(CC)CC1=C(F)C=C(C2=C3C=C(C4=CC=C(C5=C6C(=O)C7=C(CC(CC)CCCC)SC(CC(CC)CCCC)=C7C(=O)C6=C(C6=CC=C(C)S6)S5)S4)SC3=C(C3=CC(F)=C(CC(CC)CCCC)S3)C3=C2SC(C)=C3)S1'
|
| 52 |
+
|
| 53 |
if option =="🎈Acceptor":
|
| 54 |
st.subheader("👨🔬**Input the SMILES of Acceptor Molecule**")
|
| 55 |
molecule = st.text_input("👨🔬**Input the SMILES of Acceptor Molecule**", label_visibility="hidden" )
|
| 56 |
acceptor= st_ketcher(molecule )
|
| 57 |
+
st.subheader("💗**PCE prediction**")
|
| 58 |
st.subheader(f"🏆**New SMILES of edited acceptor molecules**: {acceptor}")
|
| 59 |
+
|
| 60 |
st.subheader(":black[**🧡Input the SMILES of Donor Molecule**]")
|
| 61 |
donor= st.text_input(":black[**🧡Input the SMILES of Donor Molecule**]", label_visibility="hidden")
|
| 62 |
if option =="🎈Donor":
|
| 63 |
st.subheader("👨🔬**Input the SMILES of Donor Molecule**" )
|
| 64 |
do= st.text_input("👨🔬**Input the SMILES of Donor Molecule**" , label_visibility="hidden")
|
| 65 |
donor = st_ketcher(do)
|
| 66 |
+
st.subheader("💗**PCE prediction**")
|
| 67 |
st.subheader(f"🏆**New SMILES of edited donor molecules**: {donor}")
|
| 68 |
+
|
| 69 |
st.subheader(":black[**🧡Input the SMILES of Acceptor Molecule**]")
|
| 70 |
acceptor = st.text_input(":black[**🧡Input the SMILES of Acceptor Molecule**]", label_visibility="hidden")
|
| 71 |
if option =="example":
|